![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 0000 - Introduction.pdf | 2017-07-02 00:36 | 307K | |
| 0051 - Inspecting condition of lines and hoses.pdf | 2017-07-02 00:36 | 12K | |
| 0050 - Inspecting component condition.pdf | 2017-07-02 00:36 | 17K | |
| 0053 - Inspecting components, lines and hoses.pdf | 2017-07-02 00:36 | 452K | |
| 0090 - Suspension and body structure inspection.pdf | 2017-07-02 00:36 | 78K | |
| 0091 - Water leakage and corrosion inspection.pdf | 2017-07-02 00:36 | 39K | |
| 0101 - Engine oil and filter change.pdf | 2017-07-02 00:36 | 1.4M | |
| 0560 - Adjusting valve clearance.pdf | 2017-07-02 00:36 | 345K | |
| 0561 - Checking valve clearance.pdf | 2017-07-02 00:36 | 390K | |
| 0750 - Checking and adjusting idle speed.pdf | 2017-07-02 00:36 | 478K | |
| 0758 - Checking and adjusting idle speed.pdf | 2017-07-02 00:36 | 63K | |
| 0761 - Adjusting injection timing.pdf | 2017-07-02 00:36 | 282K | |
| 0760 - Checking injection timing.pdf | 2017-07-02 00:36 | 250K | |
| 0781 - Replacing fuel prefilter.pdf | 2017-07-02 00:36 | 81K | |
| 0932 - Cleaning metal reinforced air filter element .pdf | 2017-07-02 00:36 | 42K | |
| 0780 - Replacing fuel filter.pdf | 2017-07-02 00:36 | 430K | |
| 0980 - Replacing air filter element.pdf | 2017-07-02 00:36 | 57K | |
| 0981 - Re[lacing air filter elements.pdf | 2017-07-02 00:36 | 27K | |
| 1350 - Checking condition and tension of V-belts.pdf | 2017-07-02 00:36 | 643K | |
| 1351 - Inspecting poly V-belt.pdf | 2017-07-02 00:36 | 1.1M | |
| 1470 - Checking intake & exhaust manifold seating.pdf | 2017-07-02 00:36 | 57K | |
| 1480 - Replacing oxygen sensor.pdf | 2017-07-02 00:36 | 227K | |
| 1580 - Replacing spark plugs.pdf | 2017-07-02 00:36 | 137K | |
| 1550 - Check spark plugs, replace if necessary.pdf | 2017-07-02 00:36 | 33K | |
| 2010 - Checking coolant level & antifreeze protection.pdf | 2017-07-02 00:36 | 57K | |
| 2011 - Checking coolant level.pdf | 2017-07-02 00:36 | 32K | |
| 2050 - Checking cooling & heating system.pdf | 2017-07-02 00:36 | 42K | |
| 2080 - Replacing coolant.pdf | 2017-07-02 00:36 | 172K | |
| 2290 - Adjust engine stop, retorque engine mount bolts.pdf | 2017-07-02 00:36 | 84K | |
| 2551 - Checking clutch disk for wear.pdf | 2017-07-02 00:36 | 26K | |
| 2291 - Adjust engine stop.pdf | 2017-07-02 00:36 | 101K | |
| 2601 - Manual transmission oil change.pdf | 2017-07-02 00:36 | 100K | |
| 2610 - Manualo transmission, checking & correcting oil level.pdf | 2017-07-02 00:36 | 91K | |
| 2702 - Automatic transmission fluid and filter change.pdf | 2017-07-02 00:36 | 182K | |
| 2710 - Automatic transmission, checking & correcting fluid level.pdf | 2017-07-02 00:36 | 163K | |
| 2801 - Transfer case fluid change.pdf | 2017-07-02 00:36 | 41K | |
| 2810 - Transfer case, checking & correcting fluid level.pdf | 2017-07-02 00:36 | 43K | |
| 2910 - Clutch system, checking & correcting fluid level.pdf | 2017-07-02 00:36 | 51K | |
| 2950 - Clutch system, inspect.pdf | 2017-07-02 00:36 | 122K | |
| 3022 - Inspecting & lubricating throttle linkage.pdf | 2017-07-02 00:36 | 462K | |
| 3052 - Checking and adjusting idle speed adjuster.pdf | 2017-07-02 00:36 | 48K | |
| 3251 - Inspecting self-leveling suspension.pdf | 2017-07-02 00:36 | 38K | |
| 3211 - Level control, ADS, ASD, 4MATIC, fluid level.pdf | 2017-07-02 00:36 | 175K | |
| 3310 - Front axle, checking & correcting oil level.pdf | 2017-07-02 00:36 | 33K | |
| 3353 - Checking front axle ball joints.pdf | 2017-07-02 00:36 | 172K | |
| 3355 - Checking ball joints using special tool.pdf | 2017-07-02 00:36 | 34K | |
| 3501 - Rear axle oil change.pdf | 2017-07-02 00:36 | 153K | |
| 3510 - Rear axle, checking & correcting oil level.pdf | 2017-07-02 00:36 | 148K | |
| 3565 - Rear axle mount, adjusting limiting stop.pdf | 2017-07-02 00:36 | 106K | |
| 4051 - Inspecting tires.pdf | 2017-07-02 00:36 | 37K | |
| 4050 - Inspecting & rotating wheels.pdf | 2017-07-02 00:36 | 221K | |
| 4060 - Correcting tire pressure.pdf | 2017-07-02 00:36 | 34K | |
| 4070 - Tightening wheel bolts.pdf | 2017-07-02 00:36 | 37K | |
| 4152 - Inspecting drive shaft flexible coupling.pdf | 2017-07-02 00:36 | 98K | |
| 4210 - Checking brake fluid level.pdf | 2017-07-02 00:36 | 85K | |
| 4250 - Inspecting brake lines.pdf | 2017-07-02 00:36 | 29K | |
| 4251 - Checking brake pads & disk thickness.pdf | 2017-07-02 00:36 | 203K | |
| 4256 - Inspecting parking brake cable.pdf | 2017-07-02 00:36 | 53K | |
| 4261 - Adjusting parking brake.pdf | 2017-07-02 00:36 | 256K | |
| 4252 - Inspecting & cleaning brake disks.pdf | 2017-07-02 00:36 | 455K | |
| 4280 - Replacing brake fluid.pdf | 2017-07-02 00:36 | 137K | |
| 4290 - Brake test, parking brake check.pdf | 2017-07-02 00:36 | 96K | |
| 4611 - Check power steering fluid level.pdf | 2017-07-02 00:36 | 117K | |
| 4671 - Retightening steering bolts.pdf | 2017-07-02 00:36 | 25K | |
| 4650 - Checking steering play.pdf | 2017-07-02 00:36 | 126K | |
| 4750 - Checking fuel system condition.pdf | 2017-07-02 00:36 | 161K | |
| 4971 - Retightening exhaust system connections.pdf | 2017-07-02 00:36 | 837K | |
| 5410 - Checking & correcting battery fluid level.pdf | 2017-07-02 00:36 | 68K | |
| 5451 - Checking warning & indicator lamps.pdf | 2017-07-02 00:36 | 40K | |
| 4970 - Retightening exhaust flange.pdf | 2017-07-02 00:36 | 692K | |
| 6030 - Cleaning water drains.pdf | 2017-07-02 00:36 | 326K | |
| 6190 - Removing and installing engine compartment lower panel.pdf | 2017-07-02 00:36 | 192K | |
| 7220 - Lubricating door hinges.pdf | 2017-07-02 00:36 | 29K | |
| 7221 - Lubricating door locks.pdf | 2017-07-02 00:36 | 19K | |
| 7710 - Hydraulic top, checking & correcting fluid level.pdf | 2017-07-02 00:36 | 70K | |
| 7730 - Sunroof, clean & grease rails.pdf | 2017-07-02 00:36 | 148K | |
| 7750 - Soft top, checking locking tabs.pdf | 2017-07-02 00:36 | 22K | |
| 8210 - Checking & correcting windshield washer fluid level.pdf | 2017-07-02 00:36 | 39K | |
| 8230 - Cleaning cassete deck tone head.pdf | 2017-07-02 00:36 | 14K | |
| 8231 - Cleaning antenna mast.pdf | 2017-07-02 00:36 | 25K | |
| 8251 - Headlamp & exterior lamp inspection.pdf | 2017-07-02 00:36 | 62K | |
| 8252 - Windshield & headlamp wiper & washer inspection.pdf | 2017-07-02 00:36 | 135K | |
| 8280 - Replacing windshield wiper blade.pdf | 2017-07-02 00:36 | 39K | |
| 8312 - Checking & correcting AC refrigerant charge.pdf | 2017-07-02 00:36 | 385K | |
| 8381 - Replacing dust filter for heating & ventilation.pdf | 2017-07-02 00:36 | 164K | |
| 8382 - Replacing active charcoal filter.pdf | 2017-07-02 00:36 | 73K | |
| 8383 - Replacing recirculating air filter.pdf | 2017-07-02 00:36 | 21K | |
| 8820 - Lubricating folding side mirror.pdf | 2017-07-02 00:36 | 39K | |
| 8821 - Lubricating hood.pdf | 2017-07-02 00:36 | 68K | |
| 9150 - Inspecting safety belts.pdf | 2017-07-02 00:36 | 24K | |
| 9151 - Backrest lock - check operation.pdf | 2017-07-02 00:36 | 32K | |
| 9490 - Removing & installing lower noise encapsulation panels.pdf | 2017-07-02 00:36 | 214K | |
| 9850 - Checking body for paint damage.pdf | 2017-07-02 00:36 | 62K | |
|
|---|